C12H14BrFN6O5S — CID 137298216
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(methanesulfonamido)ethoxyamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137298216) has the molecular formula C12H14BrFN6O5S and a molecular weight of 453.25 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(methanesulfonamido)ethoxyamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(methanesulfonamido)ethoxyamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137298216 |
| Molecular Formula | C12H14BrFN6O5S |
| Molecular Weight | 453.25 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(methanesulfonamido)ethoxyamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CS(=O)(=O)NCCONc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C12H14BrFN6O5S/c1-26(22,23)15-4-5-24-19-12-10(18-25-20-12)11(17-21)16-7-2-3-9(14)8(13)6-7/h2-3,6,15,21H,4-5H2,1H3,(H,16,17)(H,19,20) |
| InChIKey | MXSPPIFHWCVJBY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 150.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|