C20H29N3 — CID 137298524
N-but-3-en-2-yl-5-methyl-2-methylidene-1-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]pyrimidin-4-imine (PubChem CID 137298524) has the molecular formula C20H29N3 and a molecular weight of 311.47 g/mol. Its IUPAC name is N-but-3-en-2-yl-5-methyl-2-methylidene-1-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]pyrimidin-4-imine.
| Compound Name | N-but-3-en-2-yl-5-methyl-2-methylidene-1-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]pyrimidin-4-imine |
|---|---|
| PubChem CID | 137298524 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | N-but-3-en-2-yl-5-methyl-2-methylidene-1-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]pyrimidin-4-imine |
| SMILES | C=CC(C)/N=C1\NC(=C)N(C(/C=C\C)=C/C=C(\C)CC)C=C1C |
| InChI | InChI=1S/C20H29N3/c1-8-11-19(13-12-15(4)9-2)23-14-16(5)20(22-18(23)7)21-17(6)10-3/h8,10-14,17H,3,7,9H2,1-2,4-6H3,(H,21,22)/b11-8-,15-12+,19-13+ |
| InChIKey | IVARRBOVBFZNLS-VVQFFILNSA-N |
| XLogP | 5.06 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|