C27H33F2N5O — CID 137298732
4-cyclohexylimino-1-(3,5-difluorophenyl)-7-[[4-(dimethylamino)phenyl]methyl]-1,3,7-triazaspiro[4.4]nonan-2-one (PubChem CID 137298732) has the molecular formula C27H33F2N5O and a molecular weight of 481.59 g/mol. Its IUPAC name is 4-cyclohexylimino-1-(3,5-difluorophenyl)-7-[[4-(dimethylamino)phenyl]methyl]-1,3,7-triazaspiro[4.4]nonan-2-one.
| Compound Name | 4-cyclohexylimino-1-(3,5-difluorophenyl)-7-[[4-(dimethylamino)phenyl]methyl]-1,3,7-triazaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 137298732 |
| Molecular Formula | C27H33F2N5O |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 4-cyclohexylimino-1-(3,5-difluorophenyl)-7-[[4-(dimethylamino)phenyl]methyl]-1,3,7-triazaspiro[4.4]nonan-2-one |
| SMILES | CN(C)c1ccc(CN2CCC3(C2)/C(=N/C2CCCCC2)NC(=O)N3c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C27H33F2N5O/c1-32(2)23-10-8-19(9-11-23)17-33-13-12-27(18-33)25(30-22-6-4-3-5-7-22)31-26(35)34(27)24-15-20(28)14-21(29)16-24/h8-11,14-16,22H,3-7,12-13,17-18H2,1-2H3,(H,30,31,35) |
| InChIKey | FXRQZVQGMIOHNI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|