C21H26F2N4O — CID 137298753
4-cyclopentylimino-7-(cyclopropylmethyl)-1-(3,5-difluorophenyl)-1,3,7-triazaspiro[4.4]nonan-2-one (PubChem CID 137298753) has the molecular formula C21H26F2N4O and a molecular weight of 388.46 g/mol. Its IUPAC name is 4-cyclopentylimino-7-(cyclopropylmethyl)-1-(3,5-difluorophenyl)-1,3,7-triazaspiro[4.4]nonan-2-one.
| Compound Name | 4-cyclopentylimino-7-(cyclopropylmethyl)-1-(3,5-difluorophenyl)-1,3,7-triazaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 137298753 |
| Molecular Formula | C21H26F2N4O |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 4-cyclopentylimino-7-(cyclopropylmethyl)-1-(3,5-difluorophenyl)-1,3,7-triazaspiro[4.4]nonan-2-one |
| SMILES | O=C1N/C(=N\C2CCCC2)C2(CCN(CC3CC3)C2)N1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C21H26F2N4O/c22-15-9-16(23)11-18(10-15)27-20(28)25-19(24-17-3-1-2-4-17)21(27)7-8-26(13-21)12-14-5-6-14/h9-11,14,17H,1-8,12-13H2,(H,24,25,28) |
| InChIKey | SGEKHKZBAZUMDY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|