C23H27F2N5O — CID 137298809
4-cyclopentylimino-1-(3,5-difluorophenyl)-7-[(1-methylpyrrol-2-yl)methyl]-1,3,7-triazaspiro[4.4]nonan-2-one (PubChem CID 137298809) has the molecular formula C23H27F2N5O and a molecular weight of 427.50 g/mol. Its IUPAC name is 4-cyclopentylimino-1-(3,5-difluorophenyl)-7-[(1-methylpyrrol-2-yl)methyl]-1,3,7-triazaspiro[4.4]nonan-2-one.
| Compound Name | 4-cyclopentylimino-1-(3,5-difluorophenyl)-7-[(1-methylpyrrol-2-yl)methyl]-1,3,7-triazaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 137298809 |
| Molecular Formula | C23H27F2N5O |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 4-cyclopentylimino-1-(3,5-difluorophenyl)-7-[(1-methylpyrrol-2-yl)methyl]-1,3,7-triazaspiro[4.4]nonan-2-one |
| SMILES | Cn1cccc1CN1CCC2(C1)/C(=N/C1CCCC1)NC(=O)N2c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C23H27F2N5O/c1-28-9-4-7-19(28)14-29-10-8-23(15-29)21(26-18-5-2-3-6-18)27-22(31)30(23)20-12-16(24)11-17(25)13-20/h4,7,9,11-13,18H,2-3,5-6,8,10,14-15H2,1H3,(H,26,27,31) |
| InChIKey | DPFOWKQTBBQCCW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|