C26H29F3N4O — CID 137298837
4-cyclohexylimino-1-(3,5-difluorophenyl)-9-[(4-fluorophenyl)methyl]-1,3,9-triazaspiro[4.5]decan-2-one (PubChem CID 137298837) has the molecular formula C26H29F3N4O and a molecular weight of 470.54 g/mol. Its IUPAC name is 4-cyclohexylimino-1-(3,5-difluorophenyl)-9-[(4-fluorophenyl)methyl]-1,3,9-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclohexylimino-1-(3,5-difluorophenyl)-9-[(4-fluorophenyl)methyl]-1,3,9-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 137298837 |
| Molecular Formula | C26H29F3N4O |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 4-cyclohexylimino-1-(3,5-difluorophenyl)-9-[(4-fluorophenyl)methyl]-1,3,9-triazaspiro[4.5]decan-2-one |
| SMILES | O=C1N/C(=N\C2CCCCC2)C2(CCCN(Cc3ccc(F)cc3)C2)N1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C26H29F3N4O/c27-19-9-7-18(8-10-19)16-32-12-4-11-26(17-32)24(30-22-5-2-1-3-6-22)31-25(34)33(26)23-14-20(28)13-21(29)15-23/h7-10,13-15,22H,1-6,11-12,16-17H2,(H,30,31,34) |
| InChIKey | HAZYTOGUVCWFNB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|