C25H25F3N4O2 — CID 137298990
4-cyclopentylimino-1-(3,5-difluorophenyl)-9-(2-fluorobenzoyl)-1,3,9-triazaspiro[4.5]decan-2-one (PubChem CID 137298990) has the molecular formula C25H25F3N4O2 and a molecular weight of 470.50 g/mol. Its IUPAC name is 4-cyclopentylimino-1-(3,5-difluorophenyl)-9-(2-fluorobenzoyl)-1,3,9-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclopentylimino-1-(3,5-difluorophenyl)-9-(2-fluorobenzoyl)-1,3,9-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 137298990 |
| Molecular Formula | C25H25F3N4O2 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 4-cyclopentylimino-1-(3,5-difluorophenyl)-9-(2-fluorobenzoyl)-1,3,9-triazaspiro[4.5]decan-2-one |
| SMILES | O=C(c1ccccc1F)N1CCCC2(C1)/C(=N/C1CCCC1)NC(=O)N2c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C25H25F3N4O2/c26-16-12-17(27)14-19(13-16)32-24(34)30-23(29-18-6-1-2-7-18)25(32)10-5-11-31(15-25)22(33)20-8-3-4-9-21(20)28/h3-4,8-9,12-14,18H,1-2,5-7,10-11,15H2,(H,29,30,34) |
| InChIKey | HMFGRMSHIYKJCF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|