About CID 137299438
CID 137299438 (PubChem CID 137299438) has the molecular formula C21H21F3N4O4S
and a molecular weight of 482.48 g/mol.
Molecular Properties
| Compound Name | CID 137299438 |
| PubChem CID | 137299438 |
| Molecular Formula | C21H21F3N4O4S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | — |
| SMILES | COc1ccc(-n2nc(C3CCN([S+](=O)([O-])c4cccc(C(F)(F)F)c4)CC3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C21H21F3N4O4S/c1-32-17-7-5-16(6-8-17)28-20(29)25-19(26-28)14-9-11-27(12-10-14)33(30,31)18-4-2-3-15(13-18)21(22,23)24/h2-8,13-14H,9-12H2,1H3,(H-,25,26,29,30,31) |
| InChIKey | WPIXELUKUDNRBE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 137299438 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 137299438?
The IUPAC name of CID 137299438 (CID 137299438) is not available.
What is the SMILES notation for CID 137299438?
The canonical SMILES for CID 137299438 is COc1ccc(-n2nc(C3CCN([S+](=O)([O-])c4cccc(C(F)(F)F)c4)CC3)[nH]c2=O)cc1.
What is the InChIKey of CID 137299438?
The InChIKey is WPIXELUKUDNRBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F3N4O4S/c1-32-17-7-5-16(6-8-17)28-20(29)25-19(26-28)14-9-11-27(12-10-14)33(30,31)18-4-2-3-15(13-18)21(22,23)24/h2-8,13-14H,9-12H2,1H3,(H-,25,26,29,30,31).
What are the key properties of CID 137299438?
CID 137299438 has a molecular weight of 482.48 g/mol, XLogP of 3.37, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 137299438 is sourced from PubChem (CID 137299438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).