About CID 137299442
CID 137299442 (PubChem CID 137299442) has the molecular formula C15H17F3N4O3S
and a molecular weight of 390.39 g/mol.
Molecular Properties
| Compound Name | CID 137299442 |
| PubChem CID | 137299442 |
| Molecular Formula | C15H17F3N4O3S |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | — |
| SMILES | Cn1nc(C2CCN([S+](=O)([O-])c3cccc(C(F)(F)F)c3)CC2)[nH]c1=O |
| InChI | InChI=1S/C15H17F3N4O3S/c1-21-14(23)19-13(20-21)10-5-7-22(8-6-10)26(24,25)12-4-2-3-11(9-12)15(16,17)18/h2-4,9-10H,5-8H2,1H3,(H-,19,20,23,24,25) |
| InChIKey | UJENQFLTTFIRFB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 137299442 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 137299442?
The IUPAC name of CID 137299442 (CID 137299442) is not available.
What is the SMILES notation for CID 137299442?
The canonical SMILES for CID 137299442 is Cn1nc(C2CCN([S+](=O)([O-])c3cccc(C(F)(F)F)c3)CC2)[nH]c1=O.
What is the InChIKey of CID 137299442?
The InChIKey is UJENQFLTTFIRFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F3N4O3S/c1-21-14(23)19-13(20-21)10-5-7-22(8-6-10)26(24,25)12-4-2-3-11(9-12)15(16,17)18/h2-4,9-10H,5-8H2,1H3,(H-,19,20,23,24,25).
What are the key properties of CID 137299442?
CID 137299442 has a molecular weight of 390.39 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 137299442 is sourced from PubChem (CID 137299442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).