C20H24F2N4O3 — CID 137299517
methyl 4-cyclopentylimino-1-(3,5-difluorophenyl)-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 137299517) has the molecular formula C20H24F2N4O3 and a molecular weight of 406.43 g/mol. Its IUPAC name is methyl 4-cyclopentylimino-1-(3,5-difluorophenyl)-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | methyl 4-cyclopentylimino-1-(3,5-difluorophenyl)-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 137299517 |
| Molecular Formula | C20H24F2N4O3 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | methyl 4-cyclopentylimino-1-(3,5-difluorophenyl)-2-oxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | COC(=O)N1CCC2(CC1)/C(=N/C1CCCC1)NC(=O)N2c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C20H24F2N4O3/c1-29-19(28)25-8-6-20(7-9-25)17(23-15-4-2-3-5-15)24-18(27)26(20)16-11-13(21)10-14(22)12-16/h10-12,15H,2-9H2,1H3,(H,23,24,27) |
| InChIKey | QJBLBEGVMQCFHU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|