C26H31N5O3 — CID 137299523
benzyl 4-cyclohexylimino-2-oxo-1-pyridin-3-yl-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 137299523) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is benzyl 4-cyclohexylimino-2-oxo-1-pyridin-3-yl-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | benzyl 4-cyclohexylimino-2-oxo-1-pyridin-3-yl-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 137299523 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | benzyl 4-cyclohexylimino-2-oxo-1-pyridin-3-yl-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC2(CC1)/C(=N/C1CCCCC1)NC(=O)N2c1cccnc1 |
| InChI | InChI=1S/C26H31N5O3/c32-24-29-23(28-21-10-5-2-6-11-21)26(31(24)22-12-7-15-27-18-22)13-16-30(17-14-26)25(33)34-19-20-8-3-1-4-9-20/h1,3-4,7-9,12,15,18,21H,2,5-6,10-11,13-14,16-17,19H2,(H,28,29,32) |
| InChIKey | YSRFCKJXJDJZMB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|