C52H48N4 — CID 137299645
(12Z,14Z)-2,4,6,8,10,16-hexakis(ethenyl)-12,14-di(ethylidene)-3,7,11,15-tetraphenyl-1,5,9,13-tetrazacyclohexadeca-1,3,6,8,10,15-hexaene (PubChem CID 137299645) has the molecular formula C52H48N4 and a molecular weight of 728.98 g/mol. Its IUPAC name is (12Z,14Z)-2,4,6,8,10,16-hexakis(ethenyl)-12,14-di(ethylidene)-3,7,11,15-tetraphenyl-1,5,9,13-tetrazacyclohexadeca-1,3,6,8,10,15-hexaene.
| Compound Name | (12Z,14Z)-2,4,6,8,10,16-hexakis(ethenyl)-12,14-di(ethylidene)-3,7,11,15-tetraphenyl-1,5,9,13-tetrazacyclohexadeca-1,3,6,8,10,15-hexaene |
|---|---|
| PubChem CID | 137299645 |
| Molecular Formula | C52H48N4 |
| Molecular Weight | 728.98 g/mol |
| Exact Mass | 728.39 |
| IUPAC Name | (12Z,14Z)-2,4,6,8,10,16-hexakis(ethenyl)-12,14-di(ethylidene)-3,7,11,15-tetraphenyl-1,5,9,13-tetrazacyclohexadeca-1,3,6,8,10,15-hexaene |
| SMILES | C=Cc1nc(C=C)c(-c2ccccc2)/c(=C/C)[nH]/c(=C\C)c(-c2ccccc2)c(C=C)nc(C=C)c(-c2ccccc2)c(C=C)[nH]c(C=C)c1-c1ccccc1 |
| InChI | InChI=1S/C52H48N4/c1-9-41-49(37-29-21-17-22-30-37)42(10-2)54-45(13-5)51(39-33-25-19-26-34-39)46(14-6)56-48(16-8)52(40-35-27-20-28-36-40)47(15-7)55-44(12-4)50(43(11-3)53-41)38-31-23-18-24-32-38/h9-36,53,56H,1-5,7H2,6,8H3/b46-14-,48-16+,49-41-,50-43-,51-45-,52-47-,54-42+,55-44+ |
| InChIKey | MQSYHIFFHHPNNH-GJQOQFQWSA-N |
| XLogP | 12.63 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.98 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |