C21H13F2N5O2 — CID 137299700
6,8-bis(2-fluoro-4-pyridinyl)-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol (PubChem CID 137299700) has the molecular formula C21H13F2N5O2 and a molecular weight of 405.36 g/mol. Its IUPAC name is 6,8-bis(2-fluoro-4-pyridinyl)-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 6,8-bis(2-fluoro-4-pyridinyl)-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 137299700 |
| Molecular Formula | C21H13F2N5O2 |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 6,8-bis(2-fluoro-4-pyridinyl)-2-(furan-2-ylmethyl)imidazo[1,2-a]pyrazin-3-ol |
| SMILES | Oc1c(Cc2ccco2)nc2c(-c3ccnc(F)c3)nc(-c3ccnc(F)c3)cn12 |
| InChI | InChI=1S/C21H13F2N5O2/c22-17-8-12(3-5-24-17)16-11-28-20(19(26-16)13-4-6-25-18(23)9-13)27-15(21(28)29)10-14-2-1-7-30-14/h1-9,11,29H,10H2 |
| InChIKey | VXCHKSDLGGLCFO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|