About 2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol
2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol (PubChem CID 137299724) has the molecular formula C31H21N5O
and a molecular weight of 479.54 g/mol. Its IUPAC name is 2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol.
Molecular Properties
| Compound Name | 2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol |
| PubChem CID | 137299724 |
| Molecular Formula | C31H21N5O |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol |
| SMILES | Oc1ccccc1-c1cccc(-c2cccc(-c3cc(-c4cccnc4)nc(-c4cccnc4)n3)c2)n1 |
| InChI | InChI=1S/C31H21N5O/c37-30-14-2-1-11-25(30)27-13-4-12-26(34-27)21-7-3-8-22(17-21)28-18-29(23-9-5-15-32-19-23)36-31(35-28)24-10-6-16-33-20-24/h1-20,37H |
| InChIKey | KYXKRXVQKDWPBZ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 84.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol?
The IUPAC name of 2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol (CID 137299724) is 2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol.
What is the SMILES notation for 2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol?
The canonical SMILES for 2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol is Oc1ccccc1-c1cccc(-c2cccc(-c3cc(-c4cccnc4)nc(-c4cccnc4)n3)c2)n1.
What is the InChIKey of 2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol?
The InChIKey is KYXKRXVQKDWPBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H21N5O/c37-30-14-2-1-11-25(30)27-13-4-12-26(34-27)21-7-3-8-22(17-21)28-18-29(23-9-5-15-32-19-23)36-31(35-28)24-10-6-16-33-20-24/h1-20,37H.
What are the key properties of 2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol?
2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol has a molecular weight of 479.54 g/mol, XLogP of 6.70, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[3-(2,6-dipyridin-3-ylpyrimidin-4-yl)phenyl]-2-pyridinyl]phenol is sourced from PubChem (CID 137299724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).