About Deoxyadenosine
Deoxyadenosine (PubChem CID 13730) has the molecular formula C10H13N5O3
and a molecular weight of 251.24 g/mol. Its IUPAC name is (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol.
Molecular Properties
| Compound Name | Deoxyadenosine |
| PubChem CID | 13730 |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)CO)O |
| InChI | InChI=1S/C10H13N5O3/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(17)6(2-16)18-7/h3-7,16-17H,1-2H2,(H2,11,12,13)/t5-,6+,7+/m0/s1 |
| InChIKey | OLXZPDWKRNYJJZ-RRKCRQDMSA-N |
| XLogP | -0.50 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | 307 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze Deoxyadenosine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Deoxyadenosine?
The IUPAC name of Deoxyadenosine (CID 13730) is (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol.
What is the SMILES notation for Deoxyadenosine?
The canonical SMILES for Deoxyadenosine is C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)CO)O.
What is the InChIKey of Deoxyadenosine?
The InChIKey is OLXZPDWKRNYJJZ-RRKCRQDMSA-N. The full InChI is InChI=1S/C10H13N5O3/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(17)6(2-16)18-7/h3-7,16-17H,1-2H2,(H2,11,12,13)/t5-,6+,7+/m0/s1.
What are the key properties of Deoxyadenosine?
Deoxyadenosine has a molecular weight of 251.24 g/mol, XLogP of -0.50, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Deoxyadenosine is sourced from PubChem (CID 13730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).