C17H25N2O+ — CID 137300454
3-[[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]amino]propyl-(cyclopenta-1,4-dien-1-ylmethyl)-dimethylazanium (PubChem CID 137300454) has the molecular formula C17H25N2O+ and a molecular weight of 273.40 g/mol. Its IUPAC name is 3-[[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]amino]propyl-(cyclopenta-1,4-dien-1-ylmethyl)-dimethylazanium.
| Compound Name | 3-[[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]amino]propyl-(cyclopenta-1,4-dien-1-ylmethyl)-dimethylazanium |
|---|---|
| PubChem CID | 137300454 |
| Molecular Formula | C17H25N2O+ |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 3-[[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]amino]propyl-(cyclopenta-1,4-dien-1-ylmethyl)-dimethylazanium |
| SMILES | C[N+](C)(CCCNC(O)=C1C=CC=C1)CC1=CCC=C1 |
| InChI | InChI=1S/C17H24N2O/c1-19(2,14-15-8-3-4-9-15)13-7-12-18-17(20)16-10-5-6-11-16/h3,5-6,8-11,18H,4,7,12-14H2,1-2H3/p+1 |
| InChIKey | BVBTWYPZSKSGLR-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|