C34H33N4O4+ — CID 137300475
ethyl (3aS,4R,7R,9aS,9bR)-8,8-dicyano-7-(4-cyanophenyl)-3-hydroxy-2,9-dimethyl-1-oxo-4-(2-phenylethyl)-4,6,7,9,9a,9b-hexahydro-3aH-benzo[e]isoindol-2-ium-5-carboxylate (PubChem CID 137300475) has the molecular formula C34H33N4O4+ and a molecular weight of 561.66 g/mol. Its IUPAC name is ethyl (3aS,4R,7R,9aS,9bR)-8,8-dicyano-7-(4-cyanophenyl)-3-hydroxy-2,9-dimethyl-1-oxo-4-(2-phenylethyl)-4,6,7,9,9a,9b-hexahydro-3aH-benzo[e]isoindol-2-ium-5-carboxylate.
| Compound Name | ethyl (3aS,4R,7R,9aS,9bR)-8,8-dicyano-7-(4-cyanophenyl)-3-hydroxy-2,9-dimethyl-1-oxo-4-(2-phenylethyl)-4,6,7,9,9a,9b-hexahydro-3aH-benzo[e]isoindol-2-ium-5-carboxylate |
|---|---|
| PubChem CID | 137300475 |
| Molecular Formula | C34H33N4O4+ |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | ethyl (3aS,4R,7R,9aS,9bR)-8,8-dicyano-7-(4-cyanophenyl)-3-hydroxy-2,9-dimethyl-1-oxo-4-(2-phenylethyl)-4,6,7,9,9a,9b-hexahydro-3aH-benzo[e]isoindol-2-ium-5-carboxylate |
| SMILES | CCOC(=O)C1=C2C[C@H](c3ccc(C#N)cc3)C(C#N)(C#N)C(C)[C@H]2[C@H]2C(=O)[N+](C)=C(O)[C@H]2[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C34H32N4O4/c1-4-42-33(41)28-24(15-12-21-8-6-5-7-9-21)29-30(32(40)38(3)31(29)39)27-20(2)34(18-36,19-37)26(16-25(27)28)23-13-10-22(17-35)11-14-23/h5-11,13-14,20,24,26-27,29-30H,4,12,15-16H2,1-3H3/p+1/t20?,24-,26+,27+,29-,30+/m0/s1 |
| InChIKey | LDNAHDMSNPXLEF-GPGIPATDSA-O |
| XLogP | 4.83 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|