C16H24N2O2 — CID 137300587
methyl (2Z,5E)-2-(2-diazoethylidene)-6,10-dimethylundeca-5,9-dienoate (PubChem CID 137300587) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is methyl (2Z,5E)-2-(2-diazoethylidene)-6,10-dimethylundeca-5,9-dienoate.
| Compound Name | methyl (2Z,5E)-2-(2-diazoethylidene)-6,10-dimethylundeca-5,9-dienoate |
|---|---|
| PubChem CID | 137300587 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | methyl (2Z,5E)-2-(2-diazoethylidene)-6,10-dimethylundeca-5,9-dienoate |
| SMILES | COC(=O)/C(=C\C=[N+]=[N-])CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H24N2O2/c1-13(2)7-5-8-14(3)9-6-10-15(11-12-18-17)16(19)20-4/h7,9,11-12H,5-6,8,10H2,1-4H3/b14-9+,15-11- |
| InChIKey | LZSRKCSFXMTFJX-PVMFERMNSA-N |
| XLogP | 3.86 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|