About 5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol
5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol (PubChem CID 137300629) has the molecular formula C19H14N4O4
and a molecular weight of 362.35 g/mol. Its IUPAC name is 5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol.
Molecular Properties
| Compound Name | 5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol |
| PubChem CID | 137300629 |
| Molecular Formula | C19H14N4O4 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol |
| SMILES | Cc1ccc(-c2nc3ncc(Oc4ccc([N+](=O)[O-])cc4)cc3[nH]2)c(O)c1 |
| InChI | InChI=1S/C19H14N4O4/c1-11-2-7-15(17(24)8-11)18-21-16-9-14(10-20-19(16)22-18)27-13-5-3-12(4-6-13)23(25)26/h2-10,24H,1H3,(H,20,21,22) |
| InChIKey | XYMWUSIITOMOHX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol?
The IUPAC name of 5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol (CID 137300629) is 5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol.
What is the SMILES notation for 5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol?
The canonical SMILES for 5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol is Cc1ccc(-c2nc3ncc(Oc4ccc([N+](=O)[O-])cc4)cc3[nH]2)c(O)c1.
What is the InChIKey of 5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol?
The InChIKey is XYMWUSIITOMOHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N4O4/c1-11-2-7-15(17(24)8-11)18-21-16-9-14(10-20-19(16)22-18)27-13-5-3-12(4-6-13)23(25)26/h2-10,24H,1H3,(H,20,21,22).
What are the key properties of 5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol?
5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol has a molecular weight of 362.35 g/mol, XLogP of 4.34, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-[6-(4-nitrophenoxy)-1H-imidazo[4,5-b]pyridin-2-yl]phenol is sourced from PubChem (CID 137300629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).