C24H21FN2O7 — CID 137301266
(4aS,5aR,12aR)-7-(3-fluoro-4-pyridinyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 137301266) has the molecular formula C24H21FN2O7 and a molecular weight of 468.44 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(3-fluoro-4-pyridinyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(3-fluoro-4-pyridinyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 137301266 |
| Molecular Formula | C24H21FN2O7 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | (4aS,5aR,12aR)-7-(3-fluoro-4-pyridinyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccncc5F)c4C[C@H]3C[C@H]2CC1O |
| InChI | InChI=1S/C24H21FN2O7/c25-14-8-27-4-3-12(14)11-1-2-15(28)18-13(11)6-9-5-10-7-16(29)19(23(26)33)22(32)24(10,34)21(31)17(9)20(18)30/h1-4,8-10,16,19,28-30,34H,5-7H2,(H2,26,33)/t9-,10+,16?,19?,24+/m1/s1 |
| InChIKey | UMEGMCUDHAVGCI-DTISDYMWSA-N |
| XLogP | 0.79 |
| TPSA | 171.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|