C29H29F2N7O5 — CID 137301392
4-[5-[[(4R,5S)-5-(3,4-difluorophenyl)-2-(2-methoxyethyl)-1,2-oxazolidin-4-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]-N-hydroxypyridine-2-carboxamide (PubChem CID 137301392) has the molecular formula C29H29F2N7O5 and a molecular weight of 593.59 g/mol. Its IUPAC name is 4-[5-[[(4R,5S)-5-(3,4-difluorophenyl)-2-(2-methoxyethyl)-1,2-oxazolidin-4-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]-N-hydroxypyridine-2-carboxamide.
| Compound Name | 4-[5-[[(4R,5S)-5-(3,4-difluorophenyl)-2-(2-methoxyethyl)-1,2-oxazolidin-4-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]-N-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 137301392 |
| Molecular Formula | C29H29F2N7O5 |
| Molecular Weight | 593.59 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | 4-[5-[[(4R,5S)-5-(3,4-difluorophenyl)-2-(2-methoxyethyl)-1,2-oxazolidin-4-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]-N-hydroxypyridine-2-carboxamide |
| SMILES | COCCN1C[C@@H](NC(=O)Nc2c(C)c(-c3ccnc(C(=O)NO)c3)nn2-c2ccccc2)[C@H](c2ccc(F)c(F)c2)O1 |
| InChI | InChI=1S/C29H29F2N7O5/c1-17-25(18-10-11-32-23(15-18)28(39)36-41)35-38(20-6-4-3-5-7-20)27(17)34-29(40)33-24-16-37(12-13-42-2)43-26(24)19-8-9-21(30)22(31)14-19/h3-11,14-15,24,26,41H,12-13,16H2,1-2H3,(H,36,39)(H2,33,34,40)/t24-,26+/m1/s1 |
| InChIKey | AABQAGJSXPPHSW-RSXGOPAZSA-N |
| XLogP | 3.76 |
| TPSA | 142.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|