C28H28F2N8O5 — CID 137301394
4-[5-[[(4R,5S)-5-(5,6-difluoro-3-pyridinyl)-2-(2-methoxyethyl)-1,2-oxazolidin-4-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]-N-hydroxypyridine-2-carboxamide (PubChem CID 137301394) has the molecular formula C28H28F2N8O5 and a molecular weight of 594.58 g/mol. Its IUPAC name is 4-[5-[[(4R,5S)-5-(5,6-difluoro-3-pyridinyl)-2-(2-methoxyethyl)-1,2-oxazolidin-4-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]-N-hydroxypyridine-2-carboxamide.
| Compound Name | 4-[5-[[(4R,5S)-5-(5,6-difluoro-3-pyridinyl)-2-(2-methoxyethyl)-1,2-oxazolidin-4-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]-N-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 137301394 |
| Molecular Formula | C28H28F2N8O5 |
| Molecular Weight | 594.58 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | 4-[5-[[(4R,5S)-5-(5,6-difluoro-3-pyridinyl)-2-(2-methoxyethyl)-1,2-oxazolidin-4-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]-N-hydroxypyridine-2-carboxamide |
| SMILES | COCCN1C[C@@H](NC(=O)Nc2c(C)c(-c3ccnc(C(=O)NO)c3)nn2-c2ccccc2)[C@H](c2cnc(F)c(F)c2)O1 |
| InChI | InChI=1S/C28H28F2N8O5/c1-16-23(17-8-9-31-21(13-17)27(39)36-41)35-38(19-6-4-3-5-7-19)26(16)34-28(40)33-22-15-37(10-11-42-2)43-24(22)18-12-20(29)25(30)32-14-18/h3-9,12-14,22,24,41H,10-11,15H2,1-2H3,(H,36,39)(H2,33,34,40)/t22-,24+/m1/s1 |
| InChIKey | UWAZLYNJAUVWFS-VWNXMTODSA-N |
| XLogP | 3.16 |
| TPSA | 155.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|