C18H17F2N3OS — CID 137301730
5-[4-(difluoromethoxy)phenyl]-N-(2,4-dimethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 137301730) has the molecular formula C18H17F2N3OS and a molecular weight of 361.42 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)phenyl]-N-(2,4-dimethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-[4-(difluoromethoxy)phenyl]-N-(2,4-dimethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 137301730 |
| Molecular Formula | C18H17F2N3OS |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 5-[4-(difluoromethoxy)phenyl]-N-(2,4-dimethylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Cc1ccc(/N=C2/NN=C(c3ccc(OC(F)F)cc3)CS2)c(C)c1 |
| InChI | InChI=1S/C18H17F2N3OS/c1-11-3-8-15(12(2)9-11)21-18-23-22-16(10-25-18)13-4-6-14(7-5-13)24-17(19)20/h3-9,17H,10H2,1-2H3,(H,21,23) |
| InChIKey | KRWSWZNLUGDABN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|