C26H27FN6O3 — CID 137302035
[(3R)-pyrrolidin-3-yl] 2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylate (PubChem CID 137302035) has the molecular formula C26H27FN6O3 and a molecular weight of 490.54 g/mol. Its IUPAC name is [(3R)-pyrrolidin-3-yl] 2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylate.
| Compound Name | [(3R)-pyrrolidin-3-yl] 2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 137302035 |
| Molecular Formula | C26H27FN6O3 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | [(3R)-pyrrolidin-3-yl] 2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxylate |
| SMILES | CCc1cc(O)c(F)cc1-c1ccc2c(-c3nc4c([nH]3)CNC(C(=O)O[C@@H]3CCNC3)C4)n[nH]c2c1 |
| InChI | InChI=1S/C26H27FN6O3/c1-2-13-8-23(34)18(27)9-17(13)14-3-4-16-19(7-14)32-33-24(16)25-30-20-10-21(29-12-22(20)31-25)26(35)36-15-5-6-28-11-15/h3-4,7-9,15,21,28-29,34H,2,5-6,10-12H2,1H3,(H,30,31)(H,32,33)/t15-,21?/m1/s1 |
| InChIKey | IALXAEPAXOHXOO-RBFZIWAESA-N |
| XLogP | 2.95 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |