C22H18N4OS — CID 137302479
(8-imino-17-methylsulfanyl-9,13,16-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,9,11-hexaen-11-yl)-phenylmethanone (PubChem CID 137302479) has the molecular formula C22H18N4OS and a molecular weight of 386.48 g/mol. Its IUPAC name is (8-imino-17-methylsulfanyl-9,13,16-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,9,11-hexaen-11-yl)-phenylmethanone.
| Compound Name | (8-imino-17-methylsulfanyl-9,13,16-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,9,11-hexaen-11-yl)-phenylmethanone |
|---|---|
| PubChem CID | 137302479 |
| Molecular Formula | C22H18N4OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (8-imino-17-methylsulfanyl-9,13,16-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,9,11-hexaen-11-yl)-phenylmethanone |
| SMILES | [H]/N=c1/nc2c(C(=O)c3ccccc3)c3n(c(SC)c-2c2ccccc12)CCN3 |
| InChI | InChI=1S/C22H18N4OS/c1-28-22-16-14-9-5-6-10-15(14)20(23)25-18(16)17(21-24-11-12-26(21)22)19(27)13-7-3-2-4-8-13/h2-10,23-24H,11-12H2,1H3/b23-20+ |
| InChIKey | PAZMEGZKNRSGQK-BSYVCWPDSA-N |
| XLogP | 4.00 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|