C45H34F2N2 — CID 137302875
2-(4-cyclohexa-1,3-dien-1-ylphenyl)-4-[7-(9,9-difluorofluoren-2-yl)naphthalen-2-yl]-6-[(3Z)-hexa-1,3,5-trien-2-yl]-1,6-dihydropyrimidine (PubChem CID 137302875) has the molecular formula C45H34F2N2 and a molecular weight of 640.78 g/mol. Its IUPAC name is 2-(4-cyclohexa-1,3-dien-1-ylphenyl)-4-[7-(9,9-difluorofluoren-2-yl)naphthalen-2-yl]-6-[(3Z)-hexa-1,3,5-trien-2-yl]-1,6-dihydropyrimidine.
| Compound Name | 2-(4-cyclohexa-1,3-dien-1-ylphenyl)-4-[7-(9,9-difluorofluoren-2-yl)naphthalen-2-yl]-6-[(3Z)-hexa-1,3,5-trien-2-yl]-1,6-dihydropyrimidine |
|---|---|
| PubChem CID | 137302875 |
| Molecular Formula | C45H34F2N2 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | 2-(4-cyclohexa-1,3-dien-1-ylphenyl)-4-[7-(9,9-difluorofluoren-2-yl)naphthalen-2-yl]-6-[(3Z)-hexa-1,3,5-trien-2-yl]-1,6-dihydropyrimidine |
| SMILES | C=C/C=C\C(=C)C1C=C(c2ccc3ccc(-c4ccc5c(c4)C(F)(F)c4ccccc4-5)cc3c2)N=C(c2ccc(C3=CC=CCC3)cc2)N1 |
| InChI | InChI=1S/C45H34F2N2/c1-3-4-10-29(2)42-28-43(49-44(48-42)33-19-15-31(16-20-33)30-11-6-5-7-12-30)36-22-18-32-17-21-34(25-37(32)26-36)35-23-24-39-38-13-8-9-14-40(38)45(46,47)41(39)27-35/h3-6,8-11,13-28,42H,1-2,7,12H2,(H,48,49)/b10-4- |
| InChIKey | LOMXIRIKOWCJOF-WMZJFQQLSA-N |
| XLogP | 11.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|