C25H28BN3Si — CID 137303031
triethyl-[3-(6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinin-5-yl)naphthalen-2-yl]silane (PubChem CID 137303031) has the molecular formula C25H28BN3Si and a molecular weight of 409.42 g/mol. Its IUPAC name is triethyl-[3-(6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinin-5-yl)naphthalen-2-yl]silane.
| Compound Name | triethyl-[3-(6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinin-5-yl)naphthalen-2-yl]silane |
|---|---|
| PubChem CID | 137303031 |
| Molecular Formula | C25H28BN3Si |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | triethyl-[3-(6H-pyrazolo[1,5-c][1,3,2]benzodiazaborinin-5-yl)naphthalen-2-yl]silane |
| SMILES | CC[Si](CC)(CC)c1cc2ccccc2cc1B1Nc2ccccc2-c2ccnn21 |
| InChI | InChI=1S/C25H28BN3Si/c1-4-30(5-2,6-3)25-18-20-12-8-7-11-19(20)17-22(25)26-28-23-14-10-9-13-21(23)24-15-16-27-29(24)26/h7-18,28H,4-6H2,1-3H3 |
| InChIKey | IUWBVVVMMRXBCS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|