C25H38O9 — CID 137303250
(3S,4R,8R,11R)-4,6-dihydroxy-15-(1-hydroxy-2-methoxyethyl)-5,12-bis(methoxymethyl)-16,18-dimethyl-2,14-dioxatetracyclo[9.7.0.01,7.03,8]octadeca-9,17-dien-13-one (PubChem CID 137303250) has the molecular formula C25H38O9 and a molecular weight of 482.57 g/mol. Its IUPAC name is (3S,4R,8R,11R)-4,6-dihydroxy-15-(1-hydroxy-2-methoxyethyl)-5,12-bis(methoxymethyl)-16,18-dimethyl-2,14-dioxatetracyclo[9.7.0.01,7.03,8]octadeca-9,17-dien-13-one.
| Compound Name | (3S,4R,8R,11R)-4,6-dihydroxy-15-(1-hydroxy-2-methoxyethyl)-5,12-bis(methoxymethyl)-16,18-dimethyl-2,14-dioxatetracyclo[9.7.0.01,7.03,8]octadeca-9,17-dien-13-one |
|---|---|
| PubChem CID | 137303250 |
| Molecular Formula | C25H38O9 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | (3S,4R,8R,11R)-4,6-dihydroxy-15-(1-hydroxy-2-methoxyethyl)-5,12-bis(methoxymethyl)-16,18-dimethyl-2,14-dioxatetracyclo[9.7.0.01,7.03,8]octadeca-9,17-dien-13-one |
| SMILES | COCC(O)C1OC(=O)C(COC)C2C=C[C@@H]3C4C(O)C(COC)[C@@H](O)[C@H]3OC24C(C)=CC1C |
| InChI | InChI=1S/C25H38O9/c1-12-8-13(2)25-17(15(9-30-3)24(29)33-22(12)18(26)11-32-5)7-6-14-19(25)20(27)16(10-31-4)21(28)23(14)34-25/h6-8,12,14-23,26-28H,9-11H2,1-5H3/t12?,14-,15?,16?,17?,18?,19?,20?,21-,22?,23+,25?/m1/s1 |
| InChIKey | PBEMEFJNVSPXIA-ZVYVJORQSA-N |
| XLogP | 0.32 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|