About 1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride
1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride (PubChem CID 137303534) has the molecular formula C6H7Cl2N3O
and a molecular weight of 208.05 g/mol. Its IUPAC name is 1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride.
Molecular Properties
| Compound Name | 1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride |
| PubChem CID | 137303534 |
| Molecular Formula | C6H7Cl2N3O |
| Molecular Weight | 208.05 g/mol |
| Exact Mass | 207.00 |
| IUPAC Name | 1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride |
| SMILES | Cl.Cl.O=c1cc[nH]c2[nH]ncc12 |
| InChI | InChI=1S/C6H5N3O.2ClH/c10-5-1-2-7-6-4(5)3-8-9-6;;/h1-3H,(H2,7,8,9,10);2*1H |
| InChIKey | XNAPRPGGTYYJHN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.05 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride?
The IUPAC name of 1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride (CID 137303534) is 1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride.
What is the SMILES notation for 1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride?
The canonical SMILES for 1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride is Cl.Cl.O=c1cc[nH]c2[nH]ncc12.
What is the InChIKey of 1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride?
The InChIKey is XNAPRPGGTYYJHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O.2ClH/c10-5-1-2-7-6-4(5)3-8-9-6;;/h1-3H,(H2,7,8,9,10);2*1H.
What are the key properties of 1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride?
1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride has a molecular weight of 208.05 g/mol, XLogP of 1.09, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dihydropyrazolo[5,4-b]pyridin-4-one;dihydrochloride is sourced from PubChem (CID 137303534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).