C10H9N3O5 — CID 137303574
(E)-but-2-enedioic acid;1,7-dihydropyrazolo[5,4-b]pyridin-4-one (PubChem CID 137303574) has the molecular formula C10H9N3O5 and a molecular weight of 251.20 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1,7-dihydropyrazolo[5,4-b]pyridin-4-one.
| Compound Name | (E)-but-2-enedioic acid;1,7-dihydropyrazolo[5,4-b]pyridin-4-one |
|---|---|
| PubChem CID | 137303574 |
| Molecular Formula | C10H9N3O5 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | (E)-but-2-enedioic acid;1,7-dihydropyrazolo[5,4-b]pyridin-4-one |
| SMILES | O=C(O)/C=C/C(=O)O.O=c1cc[nH]c2[nH]ncc12 |
| InChI | InChI=1S/C6H5N3O.C4H4O4/c10-5-1-2-7-6-4(5)3-8-9-6;5-3(6)1-2-4(7)8/h1-3H,(H2,7,8,9,10);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ZWHDWFUPPYIJIP-WLHGVMLRSA-N |
| XLogP | -0.04 |
| TPSA | 136.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|