About 4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one
4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one (PubChem CID 137304189) has the molecular formula C6H4Cl3NO3
and a molecular weight of 244.46 g/mol. Its IUPAC name is 4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one.
Molecular Properties
| Compound Name | 4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one |
| PubChem CID | 137304189 |
| Molecular Formula | C6H4Cl3NO3 |
| Molecular Weight | 244.46 g/mol |
| Exact Mass | 242.93 |
| IUPAC Name | 4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one |
| SMILES | Cc1c(O)nc(C(Cl)(Cl)Cl)oc1=O |
| InChI | InChI=1S/C6H4Cl3NO3/c1-2-3(11)10-5(6(7,8)9)13-4(2)12/h11H,1H3 |
| InChIKey | XVVGYSCHMPBQQD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.46 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one?
The IUPAC name of 4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one (CID 137304189) is 4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one.
What is the SMILES notation for 4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one?
The canonical SMILES for 4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one is Cc1c(O)nc(C(Cl)(Cl)Cl)oc1=O.
What is the InChIKey of 4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one?
The InChIKey is XVVGYSCHMPBQQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl3NO3/c1-2-3(11)10-5(6(7,8)9)13-4(2)12/h11H,1H3.
What are the key properties of 4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one?
4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one has a molecular weight of 244.46 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-5-methyl-2-(trichloromethyl)-1,3-oxazin-6-one is sourced from PubChem (CID 137304189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).