C18H20N2O4 — CID 137304401
5-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]pentanamide (PubChem CID 137304401) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 5-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]pentanamide.
| Compound Name | 5-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]pentanamide |
|---|---|
| PubChem CID | 137304401 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 5-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]pentanamide |
| SMILES | O=C(CCCCc1ccccc1)N/N=C/c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C18H20N2O4/c21-15-11-10-14(17(23)18(15)24)12-19-20-16(22)9-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,10-12,21,23-24H,4-5,8-9H2,(H,20,22)/b19-12+ |
| InChIKey | GZBASFGWINTOTQ-XDHOZWIPSA-N |
| XLogP | 2.67 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|