C44H29F2N7 — CID 137305027
N-[(Z)-[2,4-bis[3-fluoro-4-(2-pyridin-2-yl-4-pyridinyl)phenyl]-6-iminocyclohexa-2,4-dien-1-ylidene]amino]aniline (PubChem CID 137305027) has the molecular formula C44H29F2N7 and a molecular weight of 693.76 g/mol. Its IUPAC name is N-[(Z)-[2,4-bis[3-fluoro-4-(2-pyridin-2-yl-4-pyridinyl)phenyl]-6-iminocyclohexa-2,4-dien-1-ylidene]amino]aniline.
| Compound Name | N-[(Z)-[2,4-bis[3-fluoro-4-(2-pyridin-2-yl-4-pyridinyl)phenyl]-6-iminocyclohexa-2,4-dien-1-ylidene]amino]aniline |
|---|---|
| PubChem CID | 137305027 |
| Molecular Formula | C44H29F2N7 |
| Molecular Weight | 693.76 g/mol |
| Exact Mass | 693.25 |
| IUPAC Name | N-[(Z)-[2,4-bis[3-fluoro-4-(2-pyridin-2-yl-4-pyridinyl)phenyl]-6-iminocyclohexa-2,4-dien-1-ylidene]amino]aniline |
| SMILES | [H]/N=C1\C=C(c2ccc(-c3ccnc(-c4ccccn4)c3)c(F)c2)C=C(c2ccc(-c3ccnc(-c4ccccn4)c3)c(F)c2)\C1=N\Nc1ccccc1 |
| InChI | InChI=1S/C44H29F2N7/c45-37-23-28(12-14-34(37)30-16-20-50-42(26-30)40-10-4-6-18-48-40)32-22-36(44(39(47)25-32)53-52-33-8-2-1-3-9-33)29-13-15-35(38(46)24-29)31-17-21-51-43(27-31)41-11-5-7-19-49-41/h1-27,47,52H/b47-39+,53-44- |
| InChIKey | LZSNSWPOROXCCC-CAPHSSOLSA-N |
| XLogP | 10.18 |
| TPSA | 99.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.76 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|