C9H12N4O2 — CID 137305471
6-tert-butyl-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione (PubChem CID 137305471) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 6-tert-butyl-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione.
| Compound Name | 6-tert-butyl-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 137305471 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 6-tert-butyl-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5,7-dione |
| SMILES | CC(C)(C)C1C(=O)Nc2ncnn2C1=O |
| InChI | InChI=1S/C9H12N4O2/c1-9(2,3)5-6(14)12-8-10-4-11-13(8)7(5)15/h4-5H,1-3H3,(H,10,11,12,14) |
| InChIKey | YZUVIIGMFUVFMQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|