About 5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one
5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one (PubChem CID 137306458) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is 5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one |
| PubChem CID | 137306458 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one |
| SMILES | CCCCCCc1c(C)nc(C)[nH]c1=O |
| InChI | InChI=1S/C12H20N2O/c1-4-5-6-7-8-11-9(2)13-10(3)14-12(11)15/h4-8H2,1-3H3,(H,13,14,15) |
| InChIKey | GGKQYDBHPZIIDN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one?
The IUPAC name of 5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one (CID 137306458) is 5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one.
What is the SMILES notation for 5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one?
The canonical SMILES for 5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one is CCCCCCc1c(C)nc(C)[nH]c1=O.
What is the InChIKey of 5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one?
The InChIKey is GGKQYDBHPZIIDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-4-5-6-7-8-11-9(2)13-10(3)14-12(11)15/h4-8H2,1-3H3,(H,13,14,15).
What are the key properties of 5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one?
5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one has a molecular weight of 208.30 g/mol, XLogP of 2.51, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexyl-2,4-dimethyl-1H-pyrimidin-6-one is sourced from PubChem (CID 137306458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).