C15H14N4O4S — CID 137307463
(5-nitrofuran-2-yl)methyl N-acetyl-N'-[(E)-benzylideneamino]carbamimidothioate (PubChem CID 137307463) has the molecular formula C15H14N4O4S and a molecular weight of 346.37 g/mol. Its IUPAC name is (5-nitrofuran-2-yl)methyl N-acetyl-N'-[(E)-benzylideneamino]carbamimidothioate.
| Compound Name | (5-nitrofuran-2-yl)methyl N-acetyl-N'-[(E)-benzylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 137307463 |
| Molecular Formula | C15H14N4O4S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | (5-nitrofuran-2-yl)methyl N-acetyl-N'-[(E)-benzylideneamino]carbamimidothioate |
| SMILES | CC(=O)N/C(=N/N=C/c1ccccc1)SCc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C15H14N4O4S/c1-11(20)17-15(18-16-9-12-5-3-2-4-6-12)24-10-13-7-8-14(23-13)19(21)22/h2-9H,10H2,1H3,(H,17,18,20)/b16-9+ |
| InChIKey | JFUYEILNYJJYRP-CXUHLZMHSA-N |
| XLogP | 2.95 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|