C24H30FN9O — CID 137307581
(E)-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]-3-[[4-(methylaminomethyl)-1-(pyrazolo[1,5-a]pyridin-7-ylmethyl)piperidin-4-yl]amino]prop-2-enamide (PubChem CID 137307581) has the molecular formula C24H30FN9O and a molecular weight of 479.56 g/mol. Its IUPAC name is (E)-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]-3-[[4-(methylaminomethyl)-1-(pyrazolo[1,5-a]pyridin-7-ylmethyl)piperidin-4-yl]amino]prop-2-enamide.
| Compound Name | (E)-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]-3-[[4-(methylaminomethyl)-1-(pyrazolo[1,5-a]pyridin-7-ylmethyl)piperidin-4-yl]amino]prop-2-enamide |
|---|---|
| PubChem CID | 137307581 |
| Molecular Formula | C24H30FN9O |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | (E)-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]-3-[[4-(methylaminomethyl)-1-(pyrazolo[1,5-a]pyridin-7-ylmethyl)piperidin-4-yl]amino]prop-2-enamide |
| SMILES | CNCC1(N/C=C(C(N)=O)\C(N)=N\c2ccnc(F)c2)CCN(Cc2cccc3ccnn23)CC1 |
| InChI | InChI=1S/C24H30FN9O/c1-28-16-24(30-14-20(23(27)35)22(26)32-17-5-9-29-21(25)13-17)7-11-33(12-8-24)15-19-4-2-3-18-6-10-31-34(18)19/h2-6,9-10,13-14,28,30H,7-8,11-12,15-16H2,1H3,(H2,27,35)(H2,26,29,32)/b20-14+ |
| InChIKey | IDRQEQHYVDKWAD-XSFVSMFZSA-N |
| XLogP | 1.07 |
| TPSA | 138.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|