C18H25F4N7O — CID 137307598
(E)-3-[[1-(aminomethyl)-4-(2,2,2-trifluoroethylamino)cyclohexyl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide (PubChem CID 137307598) has the molecular formula C18H25F4N7O and a molecular weight of 431.44 g/mol. Its IUPAC name is (E)-3-[[1-(aminomethyl)-4-(2,2,2-trifluoroethylamino)cyclohexyl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[[1-(aminomethyl)-4-(2,2,2-trifluoroethylamino)cyclohexyl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 137307598 |
| Molecular Formula | C18H25F4N7O |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (E)-3-[[1-(aminomethyl)-4-(2,2,2-trifluoroethylamino)cyclohexyl]amino]-2-[N'-(2-fluoro-4-pyridinyl)carbamimidoyl]prop-2-enamide |
| SMILES | NCC1(N/C=C(C(N)=O)\C(N)=N\c2ccnc(F)c2)CCC(NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H25F4N7O/c19-14-7-12(3-6-26-14)29-15(24)13(16(25)30)8-28-17(9-23)4-1-11(2-5-17)27-10-18(20,21)22/h3,6-8,11,27-28H,1-2,4-5,9-10,23H2,(H2,25,30)(H2,24,26,29)/b13-8+ |
| InChIKey | VIPKKFYPUKPSFV-MDWZMJQESA-N |
| XLogP | 0.96 |
| TPSA | 144.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|