C22H28FN7O — CID 137307676
(E)-3-[[1-(aminomethyl)-4-(pyridin-2-ylamino)cyclohexyl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide (PubChem CID 137307676) has the molecular formula C22H28FN7O and a molecular weight of 425.51 g/mol. Its IUPAC name is (E)-3-[[1-(aminomethyl)-4-(pyridin-2-ylamino)cyclohexyl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-[[1-(aminomethyl)-4-(pyridin-2-ylamino)cyclohexyl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 137307676 |
| Molecular Formula | C22H28FN7O |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | (E)-3-[[1-(aminomethyl)-4-(pyridin-2-ylamino)cyclohexyl]amino]-2-[N'-(4-fluorophenyl)carbamimidoyl]prop-2-enamide |
| SMILES | NCC1(N/C=C(C(N)=O)\C(N)=N\c2ccc(F)cc2)CCC(Nc2ccccn2)CC1 |
| InChI | InChI=1S/C22H28FN7O/c23-15-4-6-16(7-5-15)30-20(25)18(21(26)31)13-28-22(14-24)10-8-17(9-11-22)29-19-3-1-2-12-27-19/h1-7,12-13,17,28H,8-11,14,24H2,(H2,25,30)(H2,26,31)(H,27,29)/b18-13+ |
| InChIKey | FGCYDDFYYOEQLH-QGOAFFKASA-N |
| XLogP | 1.92 |
| TPSA | 144.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|