C18H16N4O — CID 137308248
3-[5-(1H-indol-2-yl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline (PubChem CID 137308248) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-[5-(1H-indol-2-yl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline.
| Compound Name | 3-[5-(1H-indol-2-yl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 137308248 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-[5-(1H-indol-2-yl)-1,3,4-oxadiazol-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(-c2nnc(-c3cc4ccccc4[nH]3)o2)c1 |
| InChI | InChI=1S/C18H16N4O/c1-22(2)14-8-5-7-13(10-14)17-20-21-18(23-17)16-11-12-6-3-4-9-15(12)19-16/h3-11,19H,1-2H3 |
| InChIKey | OMMQJJHLDNDHIB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |