About 2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid
2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid (PubChem CID 137308255) has the molecular formula C16H15N7O5
and a molecular weight of 385.34 g/mol. Its IUPAC name is 2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid.
Molecular Properties
| Compound Name | 2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid |
| PubChem CID | 137308255 |
| Molecular Formula | C16H15N7O5 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid |
| SMILES | Nc1nccc(-c2ccnc(-c3ccnc(N)n3)c2O)n1.O=C(O)CC(=O)O |
| InChI | InChI=1S/C13H11N7O.C3H4O4/c14-12-17-5-2-8(19-12)7-1-4-16-10(11(7)21)9-3-6-18-13(15)20-9;4-2(5)1-3(6)7/h1-6,21H,(H2,14,17,19)(H2,15,18,20);1H2,(H,4,5)(H,6,7) |
| InChIKey | OUWJZNFVXPPZMQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 211.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid?
The IUPAC name of 2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid (CID 137308255) is 2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid.
What is the SMILES notation for 2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid?
The canonical SMILES for 2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid is Nc1nccc(-c2ccnc(-c3ccnc(N)n3)c2O)n1.O=C(O)CC(=O)O.
What is the InChIKey of 2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid?
The InChIKey is OUWJZNFVXPPZMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N7O.C3H4O4/c14-12-17-5-2-8(19-12)7-1-4-16-10(11(7)21)9-3-6-18-13(15)20-9;4-2(5)1-3(6)7/h1-6,21H,(H2,14,17,19)(H2,15,18,20);1H2,(H,4,5)(H,6,7).
What are the key properties of 2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid?
2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid has a molecular weight of 385.34 g/mol, XLogP of 0.41, 4 rotatable bonds, 5 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(2-aminopyrimidin-4-yl)pyridin-3-ol;propanedioic acid is sourced from PubChem (CID 137308255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).