C21H20N4O2 — CID 137308282
N-[(4-cyanophenyl)methyl]-N-methyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide (PubChem CID 137308282) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-N-methyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-N-methyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide |
|---|---|
| PubChem CID | 137308282 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-N-methyl-4-(4-oxo-3H-quinazolin-2-yl)butanamide |
| SMILES | CN(Cc1ccc(C#N)cc1)C(=O)CCCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C21H20N4O2/c1-25(14-16-11-9-15(13-22)10-12-16)20(26)8-4-7-19-23-18-6-3-2-5-17(18)21(27)24-19/h2-3,5-6,9-12H,4,7-8,14H2,1H3,(H,23,24,27) |
| InChIKey | QGETWEMPWKAWPR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |