C23H23N5O2 — CID 137309163
N-[(4-oxo-3H-quinazolin-2-yl)methyl]-N-propan-2-yl-4-(pyrazol-1-ylmethyl)benzamide (PubChem CID 137309163) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[(4-oxo-3H-quinazolin-2-yl)methyl]-N-propan-2-yl-4-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-[(4-oxo-3H-quinazolin-2-yl)methyl]-N-propan-2-yl-4-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 137309163 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[(4-oxo-3H-quinazolin-2-yl)methyl]-N-propan-2-yl-4-(pyrazol-1-ylmethyl)benzamide |
| SMILES | CC(C)N(Cc1nc2ccccc2c(=O)[nH]1)C(=O)c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C23H23N5O2/c1-16(2)28(15-21-25-20-7-4-3-6-19(20)22(29)26-21)23(30)18-10-8-17(9-11-18)14-27-13-5-12-24-27/h3-13,16H,14-15H2,1-2H3,(H,25,26,29) |
| InChIKey | NJMJFFFXERHHMG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |