About 1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine
1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine (PubChem CID 137309182) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is 1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine |
| PubChem CID | 137309182 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine |
| SMILES | CC(C)=CCCC(C)/C=C/N1CCCC1 |
| InChI | InChI=1S/C14H25N/c1-13(2)7-6-8-14(3)9-12-15-10-4-5-11-15/h7,9,12,14H,4-6,8,10-11H2,1-3H3/b12-9+ |
| InChIKey | YDEQPCORZDHUKA-FMIVXFBMSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine?
The IUPAC name of 1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine (CID 137309182) is 1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine.
What is the SMILES notation for 1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine?
The canonical SMILES for 1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine is CC(C)=CCCC(C)/C=C/N1CCCC1.
What is the InChIKey of 1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine?
The InChIKey is YDEQPCORZDHUKA-FMIVXFBMSA-N. The full InChI is InChI=1S/C14H25N/c1-13(2)7-6-8-14(3)9-12-15-10-4-5-11-15/h7,9,12,14H,4-6,8,10-11H2,1-3H3/b12-9+.
What are the key properties of 1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine?
1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine has a molecular weight of 207.36 g/mol, XLogP of 3.98, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1E)-3,7-dimethylocta-1,6-dienyl]pyrrolidine is sourced from PubChem (CID 137309182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).