About 6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one
6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one (PubChem CID 137309426) has the molecular formula C9H14N8O3
and a molecular weight of 282.26 g/mol. Its IUPAC name is 6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one.
Molecular Properties
| Compound Name | 6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one |
| PubChem CID | 137309426 |
| Molecular Formula | C9H14N8O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one |
| SMILES | Nc1[nH]c(=O)nc2nc(/N=N/N(CCO)CCO)[nH]c12 |
| InChI | InChI=1S/C9H14N8O3/c10-6-5-7(14-9(20)12-6)13-8(11-5)15-16-17(1-3-18)2-4-19/h18-19H,1-4H2,(H4,10,11,12,13,14,20)/b16-15+ |
| InChIKey | UIVJPTOJPMVRLR-FOCLMDBBSA-N |
| XLogP | -1.49 |
| TPSA | 168.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one?
The IUPAC name of 6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one (CID 137309426) is 6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one.
What is the SMILES notation for 6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one?
The canonical SMILES for 6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one is Nc1[nH]c(=O)nc2nc(/N=N/N(CCO)CCO)[nH]c12.
What is the InChIKey of 6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one?
The InChIKey is UIVJPTOJPMVRLR-FOCLMDBBSA-N. The full InChI is InChI=1S/C9H14N8O3/c10-6-5-7(14-9(20)12-6)13-8(11-5)15-16-17(1-3-18)2-4-19/h18-19H,1-4H2,(H4,10,11,12,13,14,20)/b16-15+.
What are the key properties of 6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one?
6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one has a molecular weight of 282.26 g/mol, XLogP of -1.49, 6 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-8-[(E)-[bis(2-hydroxyethyl)amino]diazenyl]-1,7-dihydropurin-2-one is sourced from PubChem (CID 137309426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).