C11H11N5O2 — CID 137309994
(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)iminourea (PubChem CID 137309994) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is (5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)iminourea.
| Compound Name | (5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)iminourea |
|---|---|
| PubChem CID | 137309994 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)iminourea |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/N=N/C(N)=O |
| InChI | InChI=1S/C11H11N5O2/c1-7-9(13-14-11(12)18)10(17)16(15-7)8-5-3-2-4-6-8/h2-6,15H,1H3,(H2,12,18)/b14-13+ |
| InChIKey | YSOLNWRPAYFGEZ-BUHFOSPRSA-N |
| XLogP | 1.64 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|