C15H14FN5O — CID 137310294
1-(cyclopropylmethyl)-3-[(2-fluoro-4-pyridinyl)amino]-5H-pyrazolo[4,3-c]pyridin-4-one (PubChem CID 137310294) has the molecular formula C15H14FN5O and a molecular weight of 299.31 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-[(2-fluoro-4-pyridinyl)amino]-5H-pyrazolo[4,3-c]pyridin-4-one.
| Compound Name | 1-(cyclopropylmethyl)-3-[(2-fluoro-4-pyridinyl)amino]-5H-pyrazolo[4,3-c]pyridin-4-one |
|---|---|
| PubChem CID | 137310294 |
| Molecular Formula | C15H14FN5O |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-[(2-fluoro-4-pyridinyl)amino]-5H-pyrazolo[4,3-c]pyridin-4-one |
| SMILES | O=c1[nH]ccc2c1c(Nc1ccnc(F)c1)nn2CC1CC1 |
| InChI | InChI=1S/C15H14FN5O/c16-12-7-10(3-5-17-12)19-14-13-11(4-6-18-15(13)22)21(20-14)8-9-1-2-9/h3-7,9H,1-2,8H2,(H,18,22)(H,17,19,20) |
| InChIKey | BFXBXMMPGWOWII-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|