C29H22N2O7 — CID 137313857
trimethyl 14-acetyl-3,22-diazahexacyclo[10.10.1.02,10.04,9.015,23.016,21]tricosa-1,3,5,7,9,11,15(23),16,18,20-decaene-11,13,14-tricarboxylate (PubChem CID 137313857) has the molecular formula C29H22N2O7 and a molecular weight of 510.50 g/mol. Its IUPAC name is trimethyl 14-acetyl-3,22-diazahexacyclo[10.10.1.02,10.04,9.015,23.016,21]tricosa-1,3,5,7,9,11,15(23),16,18,20-decaene-11,13,14-tricarboxylate.
| Compound Name | trimethyl 14-acetyl-3,22-diazahexacyclo[10.10.1.02,10.04,9.015,23.016,21]tricosa-1,3,5,7,9,11,15(23),16,18,20-decaene-11,13,14-tricarboxylate |
|---|---|
| PubChem CID | 137313857 |
| Molecular Formula | C29H22N2O7 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | trimethyl 14-acetyl-3,22-diazahexacyclo[10.10.1.02,10.04,9.015,23.016,21]tricosa-1,3,5,7,9,11,15(23),16,18,20-decaene-11,13,14-tricarboxylate |
| SMILES | COC(=O)c1c2c3c(c4ccccc4[nH]c3c3nc4ccccc4c13)C(C(C)=O)(C(=O)OC)C2C(=O)OC |
| InChI | InChI=1S/C29H22N2O7/c1-13(32)29(28(35)38-4)22-15-10-6-8-12-17(15)31-25-21(22)19(23(29)27(34)37-3)20(26(33)36-2)18-14-9-5-7-11-16(14)30-24(18)25/h5-12,23,31H,1-4H3 |
| InChIKey | RMASBZPWKSPBEQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 124.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|