About 2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid
2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid (PubChem CID 137314458) has the molecular formula C17H13N3O5
and a molecular weight of 339.31 g/mol. Its IUPAC name is 2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid |
| PubChem CID | 137314458 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid |
| SMILES | O=C(O)Cn1c(=O)c(/C=C/c2ccc(O)c(O)c2)nc2cccnc21 |
| InChI | InChI=1S/C17H13N3O5/c21-13-6-4-10(8-14(13)22)3-5-12-17(25)20(9-15(23)24)16-11(19-12)2-1-7-18-16/h1-8,21-22H,9H2,(H,23,24)/b5-3+ |
| InChIKey | MJYVSROHHBWURT-HWKANZROSA-N |
| XLogP | 1.46 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid?
The IUPAC name of 2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid (CID 137314458) is 2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid.
What is the SMILES notation for 2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid?
The canonical SMILES for 2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid is O=C(O)Cn1c(=O)c(/C=C/c2ccc(O)c(O)c2)nc2cccnc21.
What is the InChIKey of 2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid?
The InChIKey is MJYVSROHHBWURT-HWKANZROSA-N. The full InChI is InChI=1S/C17H13N3O5/c21-13-6-4-10(8-14(13)22)3-5-12-17(25)20(9-15(23)24)16-11(19-12)2-1-7-18-16/h1-8,21-22H,9H2,(H,23,24)/b5-3+.
What are the key properties of 2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid?
2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid has a molecular weight of 339.31 g/mol, XLogP of 1.46, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-oxopyrido[2,3-b]pyrazin-4-yl]acetic acid is sourced from PubChem (CID 137314458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).