C12H18N4 — CID 137315152
N-ethyl-6-(methyliminomethyl)-1,2,4a,5-tetrahydroquinazolin-4-amine (PubChem CID 137315152) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is N-ethyl-6-(methyliminomethyl)-1,2,4a,5-tetrahydroquinazolin-4-amine.
| Compound Name | N-ethyl-6-(methyliminomethyl)-1,2,4a,5-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 137315152 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | N-ethyl-6-(methyliminomethyl)-1,2,4a,5-tetrahydroquinazolin-4-amine |
| SMILES | CCNC1=NCNC2=CC=C(/C=N/C)CC21 |
| InChI | InChI=1S/C12H18N4/c1-3-14-12-10-6-9(7-13-2)4-5-11(10)15-8-16-12/h4-5,7,10,15H,3,6,8H2,1-2H3,(H,14,16)/b13-7+ |
| InChIKey | UIRINOUHCVNOCR-NTUHNPAUSA-N |
| XLogP | 1.09 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|